C12H14N2 — CID 20689310
4-butyl-1,8-naphthyridine (PubChem CID 20689310) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 4-butyl-1,8-naphthyridine.
| Compound Name | 4-butyl-1,8-naphthyridine |
|---|---|
| PubChem CID | 20689310 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 4-butyl-1,8-naphthyridine |
| SMILES | CCCCc1ccnc2ncccc12 |
| InChI | InChI=1S/C12H14N2/c1-2-3-5-10-7-9-14-12-11(10)6-4-8-13-12/h4,6-9H,2-3,5H2,1H3 |
| InChIKey | LWFZSBJGDLXLHK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |