C10H10N2O3S — CID 174850608
2-(1,8-naphthyridin-4-yl)ethanesulfonic acid (PubChem CID 174850608) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is 2-(1,8-naphthyridin-4-yl)ethanesulfonic acid.
| Compound Name | 2-(1,8-naphthyridin-4-yl)ethanesulfonic acid |
|---|---|
| PubChem CID | 174850608 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 2-(1,8-naphthyridin-4-yl)ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCc1ccnc2ncccc12 |
| InChI | InChI=1S/C10H10N2O3S/c13-16(14,15)7-4-8-3-6-12-10-9(8)2-1-5-11-10/h1-3,5-6H,4,7H2,(H,13,14,15) |
| InChIKey | LGRZDNUDSWJXQQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|