C17H19N3O3S — CID 175273136
N,N-dimethyl-1,8-naphthyridin-4-amine;4-methylbenzenesulfonic acid (PubChem CID 175273136) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is N,N-dimethyl-1,8-naphthyridin-4-amine;4-methylbenzenesulfonic acid.
| Compound Name | N,N-dimethyl-1,8-naphthyridin-4-amine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175273136 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N,N-dimethyl-1,8-naphthyridin-4-amine;4-methylbenzenesulfonic acid |
| SMILES | CN(C)c1ccnc2ncccc12.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H11N3.C7H8O3S/c1-13(2)9-5-7-12-10-8(9)4-3-6-11-10;1-6-2-4-7(5-3-6)11(8,9)10/h3-7H,1-2H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | IHPNLEASDSKPSP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|