C16H21NO3S — CID 175852128
4-methylbenzenesulfonic acid;3-methyl-2-propylpyridine (PubChem CID 175852128) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;3-methyl-2-propylpyridine.
| Compound Name | 4-methylbenzenesulfonic acid;3-methyl-2-propylpyridine |
|---|---|
| PubChem CID | 175852128 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-methylbenzenesulfonic acid;3-methyl-2-propylpyridine |
| SMILES | CCCc1ncccc1C.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H13N.C7H8O3S/c1-3-5-9-8(2)6-4-7-10-9;1-6-2-4-7(5-3-6)11(8,9)10/h4,6-7H,3,5H2,1-2H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | ADBRJDHYNNXULC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|