C17H23NO3S — CID 162332170
2-butyl-3-methylpyridine;4-methylbenzenesulfonic acid (PubChem CID 162332170) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is 2-butyl-3-methylpyridine;4-methylbenzenesulfonic acid.
| Compound Name | 2-butyl-3-methylpyridine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 162332170 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-butyl-3-methylpyridine;4-methylbenzenesulfonic acid |
| SMILES | CCCCc1ncccc1C.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H15N.C7H8O3S/c1-3-4-7-10-9(2)6-5-8-11-10;1-6-2-4-7(5-3-6)11(8,9)10/h5-6,8H,3-4,7H2,1-2H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | KJZAYXIIZZXTTB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|