C20H34N4O4S — CID 173404341
bis(4-(3-methyl-2-pyridinyl)butan-1-amine);sulfuric acid (PubChem CID 173404341) has the molecular formula C20H34N4O4S and a molecular weight of 426.58 g/mol. Its IUPAC name is bis(4-(3-methyl-2-pyridinyl)butan-1-amine);sulfuric acid.
| Compound Name | bis(4-(3-methyl-2-pyridinyl)butan-1-amine);sulfuric acid |
|---|---|
| PubChem CID | 173404341 |
| Molecular Formula | C20H34N4O4S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | bis(4-(3-methyl-2-pyridinyl)butan-1-amine);sulfuric acid |
| SMILES | Cc1cccnc1CCCCN.Cc1cccnc1CCCCN.O=S(=O)(O)O |
| InChI | InChI=1S/2C10H16N2.H2O4S/c2*1-9-5-4-8-12-10(9)6-2-3-7-11;1-5(2,3)4/h2*4-5,8H,2-3,6-7,11H2,1H3;(H2,1,2,3,4) |
| InChIKey | DPSSZYVUMFRKPL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|