C17H23FN4 — CID 11347188
N'-[(3-fluoro-2-pyridinyl)methyl]-N'-[(3-methyl-2-pyridinyl)methyl]butane-1,4-diamine (PubChem CID 11347188) has the molecular formula C17H23FN4 and a molecular weight of 302.40 g/mol. Its IUPAC name is N'-[(3-fluoro-2-pyridinyl)methyl]-N'-[(3-methyl-2-pyridinyl)methyl]butane-1,4-diamine.
| Compound Name | N'-[(3-fluoro-2-pyridinyl)methyl]-N'-[(3-methyl-2-pyridinyl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 11347188 |
| Molecular Formula | C17H23FN4 |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | N'-[(3-fluoro-2-pyridinyl)methyl]-N'-[(3-methyl-2-pyridinyl)methyl]butane-1,4-diamine |
| SMILES | Cc1cccnc1CN(CCCCN)Cc1ncccc1F |
| InChI | InChI=1S/C17H23FN4/c1-14-6-4-9-20-16(14)12-22(11-3-2-8-19)13-17-15(18)7-5-10-21-17/h4-7,9-10H,2-3,8,11-13,19H2,1H3 |
| InChIKey | HJWLHFFOOYMGGK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|