About 2-pyridin-3-ylpyridine
2-pyridin-3-ylpyridine (PubChem CID 11389) has the molecular formula C10H8N2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 2-pyridin-3-ylpyridine.
Molecular Properties
| Compound Name | 2-pyridin-3-ylpyridine |
| PubChem CID | 11389 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 2-pyridin-3-ylpyridine |
| SMILES | c1ccc(-c2cccnc2)nc1 |
| InChI | InChI=1S/C10H8N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h1-8H |
| InChIKey | VEKIYFGCEAJDDT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pyridin-3-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-3-ylpyridine?
The IUPAC name of 2-pyridin-3-ylpyridine (CID 11389) is 2-pyridin-3-ylpyridine.
What is the SMILES notation for 2-pyridin-3-ylpyridine?
The canonical SMILES for 2-pyridin-3-ylpyridine is c1ccc(-c2cccnc2)nc1.
What is the InChIKey of 2-pyridin-3-ylpyridine?
The InChIKey is VEKIYFGCEAJDDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h1-8H.
What are the key properties of 2-pyridin-3-ylpyridine?
2-pyridin-3-ylpyridine has a molecular weight of 156.19 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-ylpyridine is sourced from PubChem (CID 11389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).