About azane;2-butyl-3-methylpyridine
azane;2-butyl-3-methylpyridine (PubChem CID 175305988) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is azane;2-butyl-3-methylpyridine.
Molecular Properties
| Compound Name | azane;2-butyl-3-methylpyridine |
| PubChem CID | 175305988 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | azane;2-butyl-3-methylpyridine |
| SMILES | CCCCc1ncccc1C.N |
| InChI | InChI=1S/C10H15N.H3N/c1-3-4-7-10-9(2)6-5-8-11-10;/h5-6,8H,3-4,7H2,1-2H3;1H3 |
| InChIKey | QWEMSGLIVDNCQR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;2-butyl-3-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-butyl-3-methylpyridine?
The IUPAC name of azane;2-butyl-3-methylpyridine (CID 175305988) is azane;2-butyl-3-methylpyridine.
What is the SMILES notation for azane;2-butyl-3-methylpyridine?
The canonical SMILES for azane;2-butyl-3-methylpyridine is CCCCc1ncccc1C.N.
What is the InChIKey of azane;2-butyl-3-methylpyridine?
The InChIKey is QWEMSGLIVDNCQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.H3N/c1-3-4-7-10-9(2)6-5-8-11-10;/h5-6,8H,3-4,7H2,1-2H3;1H3.
What are the key properties of azane;2-butyl-3-methylpyridine?
azane;2-butyl-3-methylpyridine has a molecular weight of 166.27 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-butyl-3-methylpyridine is sourced from PubChem (CID 175305988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).