C13H16N2 — CID 170078486
8-tert-butyl-5-methyl-1,6-naphthyridine (PubChem CID 170078486) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 8-tert-butyl-5-methyl-1,6-naphthyridine.
| Compound Name | 8-tert-butyl-5-methyl-1,6-naphthyridine |
|---|---|
| PubChem CID | 170078486 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 8-tert-butyl-5-methyl-1,6-naphthyridine |
| SMILES | Cc1ncc(C(C)(C)C)c2ncccc12 |
| InChI | InChI=1S/C13H16N2/c1-9-10-6-5-7-14-12(10)11(8-15-9)13(2,3)4/h5-8H,1-4H3 |
| InChIKey | RXPRBIHGVCMEHC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |