About 8-tert-butyl-5-methyl-1,6-naphthyridine
8-tert-butyl-5-methyl-1,6-naphthyridine (PubChem CID 170078486) has the molecular formula C13H16N2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 8-tert-butyl-5-methyl-1,6-naphthyridine.
Molecular Properties
| Compound Name | 8-tert-butyl-5-methyl-1,6-naphthyridine |
| PubChem CID | 170078486 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 8-tert-butyl-5-methyl-1,6-naphthyridine |
| SMILES | Cc1ncc(C(C)(C)C)c2ncccc12 |
| InChI | InChI=1S/C13H16N2/c1-9-10-6-5-7-14-12(10)11(8-15-9)13(2,3)4/h5-8H,1-4H3 |
| InChIKey | RXPRBIHGVCMEHC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-tert-butyl-5-methyl-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-5-methyl-1,6-naphthyridine?
The IUPAC name of 8-tert-butyl-5-methyl-1,6-naphthyridine (CID 170078486) is 8-tert-butyl-5-methyl-1,6-naphthyridine.
What is the SMILES notation for 8-tert-butyl-5-methyl-1,6-naphthyridine?
The canonical SMILES for 8-tert-butyl-5-methyl-1,6-naphthyridine is Cc1ncc(C(C)(C)C)c2ncccc12.
What is the InChIKey of 8-tert-butyl-5-methyl-1,6-naphthyridine?
The InChIKey is RXPRBIHGVCMEHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-9-10-6-5-7-14-12(10)11(8-15-9)13(2,3)4/h5-8H,1-4H3.
What are the key properties of 8-tert-butyl-5-methyl-1,6-naphthyridine?
8-tert-butyl-5-methyl-1,6-naphthyridine has a molecular weight of 200.28 g/mol, XLogP of 3.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-5-methyl-1,6-naphthyridine is sourced from PubChem (CID 170078486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).