About 5,8-ditert-butylquinoline;ethane
5,8-ditert-butylquinoline;ethane (PubChem CID 142102448) has the molecular formula C19H29N
and a molecular weight of 271.45 g/mol. Its IUPAC name is 5,8-ditert-butylquinoline;ethane.
Molecular Properties
| Compound Name | 5,8-ditert-butylquinoline;ethane |
| PubChem CID | 142102448 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 5,8-ditert-butylquinoline;ethane |
| SMILES | CC.CC(C)(C)c1ccc(C(C)(C)C)c2ncccc12 |
| InChI | InChI=1S/C17H23N.C2H6/c1-16(2,3)13-9-10-14(17(4,5)6)15-12(13)8-7-11-18-15;1-2/h7-11H,1-6H3;1-2H3 |
| InChIKey | BIUJQDXLOZYFAN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,8-ditert-butylquinoline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-ditert-butylquinoline;ethane?
The IUPAC name of 5,8-ditert-butylquinoline;ethane (CID 142102448) is 5,8-ditert-butylquinoline;ethane.
What is the SMILES notation for 5,8-ditert-butylquinoline;ethane?
The canonical SMILES for 5,8-ditert-butylquinoline;ethane is CC.CC(C)(C)c1ccc(C(C)(C)C)c2ncccc12.
What is the InChIKey of 5,8-ditert-butylquinoline;ethane?
The InChIKey is BIUJQDXLOZYFAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N.C2H6/c1-16(2,3)13-9-10-14(17(4,5)6)15-12(13)8-7-11-18-15;1-2/h7-11H,1-6H3;1-2H3.
What are the key properties of 5,8-ditert-butylquinoline;ethane?
5,8-ditert-butylquinoline;ethane has a molecular weight of 271.45 g/mol, XLogP of 5.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-ditert-butylquinoline;ethane is sourced from PubChem (CID 142102448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).