C10H10N2 — CID 58593146
5,8-dimethyl-1,7-naphthyridine (PubChem CID 58593146) has the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 5,8-dimethyl-1,7-naphthyridine.
| Compound Name | 5,8-dimethyl-1,7-naphthyridine |
|---|---|
| PubChem CID | 58593146 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 5,8-dimethyl-1,7-naphthyridine |
| SMILES | Cc1cnc(C)c2ncccc12 |
| InChI | InChI=1S/C10H10N2/c1-7-6-12-8(2)10-9(7)4-3-5-11-10/h3-6H,1-2H3 |
| InChIKey | ADKOFVQEBSVFCK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |