C12H9N3 — CID 163955325
6-methylpyrido[2,3-c][1,5]naphthyridine (PubChem CID 163955325) has the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 6-methylpyrido[2,3-c][1,5]naphthyridine.
| Compound Name | 6-methylpyrido[2,3-c][1,5]naphthyridine |
|---|---|
| PubChem CID | 163955325 |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 6-methylpyrido[2,3-c][1,5]naphthyridine |
| SMILES | Cc1nc2cccnc2c2cccnc12 |
| InChI | InChI=1S/C12H9N3/c1-8-11-9(4-2-6-13-11)12-10(15-8)5-3-7-14-12/h2-7H,1H3 |
| InChIKey | SCVMMCJOXVEZMC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|