C28H32N2 — CID 142526098
5-(2,4-ditert-butyl-3-ethylphenyl)-1,10-phenanthroline (PubChem CID 142526098) has the molecular formula C28H32N2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 5-(2,4-ditert-butyl-3-ethylphenyl)-1,10-phenanthroline.
| Compound Name | 5-(2,4-ditert-butyl-3-ethylphenyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 142526098 |
| Molecular Formula | C28H32N2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 5-(2,4-ditert-butyl-3-ethylphenyl)-1,10-phenanthroline |
| SMILES | CCc1c(C(C)(C)C)ccc(-c2cc3cccnc3c3ncccc23)c1C(C)(C)C |
| InChI | InChI=1S/C28H32N2/c1-8-19-23(27(2,3)4)14-13-20(24(19)28(5,6)7)22-17-18-11-9-15-29-25(18)26-21(22)12-10-16-30-26/h9-17H,8H2,1-7H3 |
| InChIKey | RLKXOSGNVAUVNY-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|