C21H27N3 — CID 129101866
N-tert-butyl-N-(2,2-dimethylpropyl)-1,10-phenanthrolin-5-amine (PubChem CID 129101866) has the molecular formula C21H27N3 and a molecular weight of 321.47 g/mol. Its IUPAC name is N-tert-butyl-N-(2,2-dimethylpropyl)-1,10-phenanthrolin-5-amine.
| Compound Name | N-tert-butyl-N-(2,2-dimethylpropyl)-1,10-phenanthrolin-5-amine |
|---|---|
| PubChem CID | 129101866 |
| Molecular Formula | C21H27N3 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | N-tert-butyl-N-(2,2-dimethylpropyl)-1,10-phenanthrolin-5-amine |
| SMILES | CC(C)(C)CN(c1cc2cccnc2c2ncccc12)C(C)(C)C |
| InChI | InChI=1S/C21H27N3/c1-20(2,3)14-24(21(4,5)6)17-13-15-9-7-11-22-18(15)19-16(17)10-8-12-23-19/h7-13H,14H2,1-6H3 |
| InChIKey | SVVGGXHWTCJSFF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|