C34H30N2 — CID 132549358
12,25-ditert-butyl-8,21-diazaheptacyclo[13.11.1.12,10.04,9.017,22.023,27.014,28]octacosa-1(26),2(28),3,5,7,9,11,13,15(27),16,18,20,22,24-tetradecaene (PubChem CID 132549358) has the molecular formula C34H30N2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 12,25-ditert-butyl-8,21-diazaheptacyclo[13.11.1.12,10.04,9.017,22.023,27.014,28]octacosa-1(26),2(28),3,5,7,9,11,13,15(27),16,18,20,22,24-tetradecaene.
| Compound Name | 12,25-ditert-butyl-8,21-diazaheptacyclo[13.11.1.12,10.04,9.017,22.023,27.014,28]octacosa-1(26),2(28),3,5,7,9,11,13,15(27),16,18,20,22,24-tetradecaene |
|---|---|
| PubChem CID | 132549358 |
| Molecular Formula | C34H30N2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 12,25-ditert-butyl-8,21-diazaheptacyclo[13.11.1.12,10.04,9.017,22.023,27.014,28]octacosa-1(26),2(28),3,5,7,9,11,13,15(27),16,18,20,22,24-tetradecaene |
| SMILES | CC(C)(C)c1cc2c3cc4cccnc4c4cc(C(C)(C)C)cc(c5cc6cccnc6c(c1)c25)c34 |
| InChI | InChI=1S/C34H30N2/c1-33(2,3)21-15-25-23-13-20-10-8-12-36-32(20)28-18-22(34(4,5)6)16-26(30(23)28)24-14-19-9-7-11-35-31(19)27(17-21)29(24)25/h7-18H,1-6H3 |
| InChIKey | RCRWOFCYQRGWTM-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|