C22H29NO2 — CID 102526879
2,7-ditert-butyl-9-ethylcarbazole-3,6-diol (PubChem CID 102526879) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-ethylcarbazole-3,6-diol.
| Compound Name | 2,7-ditert-butyl-9-ethylcarbazole-3,6-diol |
|---|---|
| PubChem CID | 102526879 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 2,7-ditert-butyl-9-ethylcarbazole-3,6-diol |
| SMILES | CCn1c2cc(C(C)(C)C)c(O)cc2c2cc(O)c(C(C)(C)C)cc21 |
| InChI | InChI=1S/C22H29NO2/c1-8-23-17-11-15(21(2,3)4)19(24)9-13(17)14-10-20(25)16(12-18(14)23)22(5,6)7/h9-12,24-25H,8H2,1-7H3 |
| InChIKey | KDTXXAHAXXSWBM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |