About bis(2-tert-butyl-4-ethylphenol);methane
bis(2-tert-butyl-4-ethylphenol);methane (PubChem CID 174954816) has the molecular formula C25H40O2
and a molecular weight of 372.59 g/mol. Its IUPAC name is bis(2-tert-butyl-4-ethylphenol);methane.
Molecular Properties
| Compound Name | bis(2-tert-butyl-4-ethylphenol);methane |
| PubChem CID | 174954816 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | bis(2-tert-butyl-4-ethylphenol);methane |
| SMILES | C.CCc1ccc(O)c(C(C)(C)C)c1.CCc1ccc(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/2C12H18O.CH4/c2*1-5-9-6-7-11(13)10(8-9)12(2,3)4;/h2*6-8,13H,5H2,1-4H3;1H4 |
| InChIKey | SCWANUGLHKZJIC-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(2-tert-butyl-4-ethylphenol);methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-tert-butyl-4-ethylphenol);methane?
The IUPAC name of bis(2-tert-butyl-4-ethylphenol);methane (CID 174954816) is bis(2-tert-butyl-4-ethylphenol);methane.
What is the SMILES notation for bis(2-tert-butyl-4-ethylphenol);methane?
The canonical SMILES for bis(2-tert-butyl-4-ethylphenol);methane is C.CCc1ccc(O)c(C(C)(C)C)c1.CCc1ccc(O)c(C(C)(C)C)c1.
What is the InChIKey of bis(2-tert-butyl-4-ethylphenol);methane?
The InChIKey is SCWANUGLHKZJIC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H18O.CH4/c2*1-5-9-6-7-11(13)10(8-9)12(2,3)4;/h2*6-8,13H,5H2,1-4H3;1H4.
What are the key properties of bis(2-tert-butyl-4-ethylphenol);methane?
bis(2-tert-butyl-4-ethylphenol);methane has a molecular weight of 372.59 g/mol, XLogP of 7.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-tert-butyl-4-ethylphenol);methane is sourced from PubChem (CID 174954816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).