C22H30O2 — CID 54333604
2,6-ditert-butyl-4-(5-ethyl-2-hydroxyphenyl)phenol (PubChem CID 54333604) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(5-ethyl-2-hydroxyphenyl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(5-ethyl-2-hydroxyphenyl)phenol |
|---|---|
| PubChem CID | 54333604 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 2,6-ditert-butyl-4-(5-ethyl-2-hydroxyphenyl)phenol |
| SMILES | CCc1ccc(O)c(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C22H30O2/c1-8-14-9-10-19(23)16(11-14)15-12-17(21(2,3)4)20(24)18(13-15)22(5,6)7/h9-13,23-24H,8H2,1-7H3 |
| InChIKey | TTWVGYSRYBKXFG-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |