C16H18O3 — CID 101303147
5-(3,5-diethylphenyl)benzene-1,2,4-triol (PubChem CID 101303147) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 5-(3,5-diethylphenyl)benzene-1,2,4-triol.
| Compound Name | 5-(3,5-diethylphenyl)benzene-1,2,4-triol |
|---|---|
| PubChem CID | 101303147 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 5-(3,5-diethylphenyl)benzene-1,2,4-triol |
| SMILES | CCc1cc(CC)cc(-c2cc(O)c(O)cc2O)c1 |
| InChI | InChI=1S/C16H18O3/c1-3-10-5-11(4-2)7-12(6-10)13-8-15(18)16(19)9-14(13)17/h5-9,17-19H,3-4H2,1-2H3 |
| InChIKey | KMEMXRYKUUSUDN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|