C23H33NO — CID 71376111
2,6-ditert-butyl-4-[(4-ethylanilino)methyl]phenol (PubChem CID 71376111) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(4-ethylanilino)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(4-ethylanilino)methyl]phenol |
|---|---|
| PubChem CID | 71376111 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | 2,6-ditert-butyl-4-[(4-ethylanilino)methyl]phenol |
| SMILES | CCc1ccc(NCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C23H33NO/c1-8-16-9-11-18(12-10-16)24-15-17-13-19(22(2,3)4)21(25)20(14-17)23(5,6)7/h9-14,24-25H,8,15H2,1-7H3 |
| InChIKey | YKUHRNNEPKFTAS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |