C12H18OS — CID 15789894
2-tert-butyl-4-ethyl-6-sulfanylphenol (PubChem CID 15789894) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is 2-tert-butyl-4-ethyl-6-sulfanylphenol.
| Compound Name | 2-tert-butyl-4-ethyl-6-sulfanylphenol |
|---|---|
| PubChem CID | 15789894 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-tert-butyl-4-ethyl-6-sulfanylphenol |
| SMILES | CCc1cc(S)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C12H18OS/c1-5-8-6-9(12(2,3)4)11(13)10(14)7-8/h6-7,13-14H,5H2,1-4H3 |
| InChIKey | UDMMXNPKSVZZPV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|