C29H40O3 — CID 91477113
2-[2-tert-butyl-6-[1-(3-tert-butyl-5-ethyl-2-hydroxyphenyl)ethyl]-4-ethylphenyl]prop-2-enoic acid (PubChem CID 91477113) has the molecular formula C29H40O3 and a molecular weight of 436.64 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-[1-(3-tert-butyl-5-ethyl-2-hydroxyphenyl)ethyl]-4-ethylphenyl]prop-2-enoic acid.
| Compound Name | 2-[2-tert-butyl-6-[1-(3-tert-butyl-5-ethyl-2-hydroxyphenyl)ethyl]-4-ethylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 91477113 |
| Molecular Formula | C29H40O3 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | 2-[2-tert-butyl-6-[1-(3-tert-butyl-5-ethyl-2-hydroxyphenyl)ethyl]-4-ethylphenyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1c(C(C)c2cc(CC)cc(C(C)(C)C)c2O)cc(CC)cc1C(C)(C)C |
| InChI | InChI=1S/C29H40O3/c1-11-19-13-21(25(18(4)27(31)32)23(15-19)28(5,6)7)17(3)22-14-20(12-2)16-24(26(22)30)29(8,9)10/h13-17,30H,4,11-12H2,1-3,5-10H3,(H,31,32) |
| InChIKey | SJYGJAYUCXIYTL-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|