C34H46O2 — CID 101304331
2-tert-butyl-6-[(3-tert-butyl-5-ethyl-2-hydroxyphenyl)-(4-propan-2-ylphenyl)methyl]-4-ethylphenol (PubChem CID 101304331) has the molecular formula C34H46O2 and a molecular weight of 486.74 g/mol. Its IUPAC name is 2-tert-butyl-6-[(3-tert-butyl-5-ethyl-2-hydroxyphenyl)-(4-propan-2-ylphenyl)methyl]-4-ethylphenol.
| Compound Name | 2-tert-butyl-6-[(3-tert-butyl-5-ethyl-2-hydroxyphenyl)-(4-propan-2-ylphenyl)methyl]-4-ethylphenol |
|---|---|
| PubChem CID | 101304331 |
| Molecular Formula | C34H46O2 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | 2-tert-butyl-6-[(3-tert-butyl-5-ethyl-2-hydroxyphenyl)-(4-propan-2-ylphenyl)methyl]-4-ethylphenol |
| SMILES | CCc1cc(C(c2ccc(C(C)C)cc2)c2cc(CC)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C34H46O2/c1-11-22-17-26(31(35)28(19-22)33(5,6)7)30(25-15-13-24(14-16-25)21(3)4)27-18-23(12-2)20-29(32(27)36)34(8,9)10/h13-21,30,35-36H,11-12H2,1-10H3 |
| InChIKey | OEAKNDFFBHKOSJ-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|