C35H52O3 — CID 142655058
[2-[1-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]-4,6-bis(2,2-dimethylpropyl)phenyl] prop-2-enoate (PubChem CID 142655058) has the molecular formula C35H52O3 and a molecular weight of 520.80 g/mol. Its IUPAC name is [2-[1-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]-4,6-bis(2,2-dimethylpropyl)phenyl] prop-2-enoate.
| Compound Name | [2-[1-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]-4,6-bis(2,2-dimethylpropyl)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 142655058 |
| Molecular Formula | C35H52O3 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.39 |
| IUPAC Name | [2-[1-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]-4,6-bis(2,2-dimethylpropyl)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(CC(C)(C)C)cc(CC(C)(C)C)cc1C(C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C35H52O3/c1-15-29(36)38-31-24(21-33(6,7)8)16-23(20-32(3,4)5)17-27(31)22(2)26-18-25(34(9,10)11)19-28(30(26)37)35(12,13)14/h15-19,22,37H,1,20-21H2,2-14H3 |
| InChIKey | CHIYVIYPJQEEJM-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|