C37H52O4S — CID 91130391
[2,4-ditert-butyl-6-[1-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 91130391) has the molecular formula C37H52O4S and a molecular weight of 592.89 g/mol. Its IUPAC name is [2,4-ditert-butyl-6-[1-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2,4-ditert-butyl-6-[1-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91130391 |
| Molecular Formula | C37H52O4S |
| Molecular Weight | 592.89 g/mol |
| Exact Mass | 592.36 |
| IUPAC Name | [2,4-ditert-butyl-6-[1-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(C(C)c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)cc(C(C)(C)C)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C37H52O4S/c1-23-15-17-27(18-16-23)42(39,40)41-33-29(20-26(35(6,7)8)22-31(33)37(12,13)14)24(2)28-19-25(34(3,4)5)21-30(32(28)38)36(9,10)11/h15-22,24,38H,1-14H3 |
| InChIKey | NFESCCJUTZNPEV-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.89 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|