C33H50O3 — CID 58798048
2,4-ditert-butyl-6-[1-[3,5-ditert-butyl-2-(oxiran-2-ylmethoxy)phenyl]ethyl]phenol (PubChem CID 58798048) has the molecular formula C33H50O3 and a molecular weight of 494.76 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-[3,5-ditert-butyl-2-(oxiran-2-ylmethoxy)phenyl]ethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[1-[3,5-ditert-butyl-2-(oxiran-2-ylmethoxy)phenyl]ethyl]phenol |
|---|---|
| PubChem CID | 58798048 |
| Molecular Formula | C33H50O3 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.38 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-[3,5-ditert-butyl-2-(oxiran-2-ylmethoxy)phenyl]ethyl]phenol |
| SMILES | CC(c1cc(C(C)(C)C)cc(C(C)(C)C)c1O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OCC1CO1 |
| InChI | InChI=1S/C33H50O3/c1-20(24-14-21(30(2,3)4)16-26(28(24)34)32(8,9)10)25-15-22(31(5,6)7)17-27(33(11,12)13)29(25)36-19-23-18-35-23/h14-17,20,23,34H,18-19H2,1-13H3 |
| InChIKey | TVVUHCRVAGIVCO-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|