C38H58O6 — CID 87442682
2-[1-[2,6-ditert-butyl-4-[3,5-ditert-butyl-4-[1-(oxiran-2-ylmethoxy)ethoxy]phenyl]phenoxy]ethoxymethyl]oxirane (PubChem CID 87442682) has the molecular formula C38H58O6 and a molecular weight of 610.88 g/mol. Its IUPAC name is 2-[1-[2,6-ditert-butyl-4-[3,5-ditert-butyl-4-[1-(oxiran-2-ylmethoxy)ethoxy]phenyl]phenoxy]ethoxymethyl]oxirane.
| Compound Name | 2-[1-[2,6-ditert-butyl-4-[3,5-ditert-butyl-4-[1-(oxiran-2-ylmethoxy)ethoxy]phenyl]phenoxy]ethoxymethyl]oxirane |
|---|---|
| PubChem CID | 87442682 |
| Molecular Formula | C38H58O6 |
| Molecular Weight | 610.88 g/mol |
| Exact Mass | 610.42 |
| IUPAC Name | 2-[1-[2,6-ditert-butyl-4-[3,5-ditert-butyl-4-[1-(oxiran-2-ylmethoxy)ethoxy]phenyl]phenoxy]ethoxymethyl]oxirane |
| SMILES | CC(OCC1CO1)Oc1c(C(C)(C)C)cc(-c2cc(C(C)(C)C)c(OC(C)OCC3CO3)c(C(C)(C)C)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C38H58O6/c1-23(39-19-27-21-41-27)43-33-29(35(3,4)5)15-25(16-30(33)36(6,7)8)26-17-31(37(9,10)11)34(32(18-26)38(12,13)14)44-24(2)40-20-28-22-42-28/h15-18,23-24,27-28H,19-22H2,1-14H3 |
| InChIKey | KGVLQEGKBZQOMB-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.88 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|