C29H40O6 — CID 87443315
2-[1-[4-[2-[3,5-dimethyl-4-[1-(oxiran-2-ylmethoxy)ethoxy]phenyl]propan-2-yl]-2,6-dimethylphenoxy]ethoxymethyl]oxirane (PubChem CID 87443315) has the molecular formula C29H40O6 and a molecular weight of 484.63 g/mol. Its IUPAC name is 2-[1-[4-[2-[3,5-dimethyl-4-[1-(oxiran-2-ylmethoxy)ethoxy]phenyl]propan-2-yl]-2,6-dimethylphenoxy]ethoxymethyl]oxirane.
| Compound Name | 2-[1-[4-[2-[3,5-dimethyl-4-[1-(oxiran-2-ylmethoxy)ethoxy]phenyl]propan-2-yl]-2,6-dimethylphenoxy]ethoxymethyl]oxirane |
|---|---|
| PubChem CID | 87443315 |
| Molecular Formula | C29H40O6 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 2-[1-[4-[2-[3,5-dimethyl-4-[1-(oxiran-2-ylmethoxy)ethoxy]phenyl]propan-2-yl]-2,6-dimethylphenoxy]ethoxymethyl]oxirane |
| SMILES | Cc1cc(C(C)(C)c2cc(C)c(OC(C)OCC3CO3)c(C)c2)cc(C)c1OC(C)OCC1CO1 |
| InChI | InChI=1S/C29H40O6/c1-17-9-23(10-18(2)27(17)34-21(5)30-13-25-15-32-25)29(7,8)24-11-19(3)28(20(4)12-24)35-22(6)31-14-26-16-33-26/h9-12,21-22,25-26H,13-16H2,1-8H3 |
| InChIKey | CFTCSRNXIYHMNG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|