C29H32O6 — CID 87427791
2-[1-[2-methyl-4-[4-[4-[1-(oxiran-2-ylmethoxy)ethoxy]phenyl]phenyl]phenoxy]ethoxymethyl]oxirane (PubChem CID 87427791) has the molecular formula C29H32O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is 2-[1-[2-methyl-4-[4-[4-[1-(oxiran-2-ylmethoxy)ethoxy]phenyl]phenyl]phenoxy]ethoxymethyl]oxirane.
| Compound Name | 2-[1-[2-methyl-4-[4-[4-[1-(oxiran-2-ylmethoxy)ethoxy]phenyl]phenyl]phenoxy]ethoxymethyl]oxirane |
|---|---|
| PubChem CID | 87427791 |
| Molecular Formula | C29H32O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 2-[1-[2-methyl-4-[4-[4-[1-(oxiran-2-ylmethoxy)ethoxy]phenyl]phenyl]phenoxy]ethoxymethyl]oxirane |
| SMILES | Cc1cc(-c2ccc(-c3ccc(OC(C)OCC4CO4)cc3)cc2)ccc1OC(C)OCC1CO1 |
| InChI | InChI=1S/C29H32O6/c1-19-14-25(10-13-29(19)35-21(3)31-16-28-18-33-28)24-6-4-22(5-7-24)23-8-11-26(12-9-23)34-20(2)30-15-27-17-32-27/h4-14,20-21,27-28H,15-18H2,1-3H3 |
| InChIKey | FAVITLHUQCIVOO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|