C21H24O4 — CID 142851433
2-[[2,6-dimethyl-4-[3-methyl-4-(oxiran-2-ylmethoxy)phenyl]phenoxy]methyl]oxirane (PubChem CID 142851433) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-[[2,6-dimethyl-4-[3-methyl-4-(oxiran-2-ylmethoxy)phenyl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[2,6-dimethyl-4-[3-methyl-4-(oxiran-2-ylmethoxy)phenyl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 142851433 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 2-[[2,6-dimethyl-4-[3-methyl-4-(oxiran-2-ylmethoxy)phenyl]phenoxy]methyl]oxirane |
| SMILES | Cc1cc(-c2cc(C)c(OCC3CO3)c(C)c2)ccc1OCC1CO1 |
| InChI | InChI=1S/C21H24O4/c1-13-6-16(4-5-20(13)24-11-18-9-22-18)17-7-14(2)21(15(3)8-17)25-12-19-10-23-19/h4-8,18-19H,9-12H2,1-3H3 |
| InChIKey | LSPMXQWHAQIKHF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|