C28H38O6 — CID 101109293
2-[3-[4-[3,5-dimethyl-4-[3-(oxiran-2-ylmethoxy)propoxy]phenyl]-2,6-dimethylphenoxy]propoxymethyl]oxirane (PubChem CID 101109293) has the molecular formula C28H38O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is 2-[3-[4-[3,5-dimethyl-4-[3-(oxiran-2-ylmethoxy)propoxy]phenyl]-2,6-dimethylphenoxy]propoxymethyl]oxirane.
| Compound Name | 2-[3-[4-[3,5-dimethyl-4-[3-(oxiran-2-ylmethoxy)propoxy]phenyl]-2,6-dimethylphenoxy]propoxymethyl]oxirane |
|---|---|
| PubChem CID | 101109293 |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 2-[3-[4-[3,5-dimethyl-4-[3-(oxiran-2-ylmethoxy)propoxy]phenyl]-2,6-dimethylphenoxy]propoxymethyl]oxirane |
| SMILES | Cc1cc(-c2cc(C)c(OCCCOCC3CO3)c(C)c2)cc(C)c1OCCCOCC1CO1 |
| InChI | InChI=1S/C28H38O6/c1-19-11-23(12-20(2)27(19)31-9-5-7-29-15-25-17-33-25)24-13-21(3)28(22(4)14-24)32-10-6-8-30-16-26-18-34-26/h11-14,25-26H,5-10,15-18H2,1-4H3 |
| InChIKey | VAQKMLILOAVFFF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|