C19H20INO4S — CID 129210392
4-amino-2-iodo-6-[3-methyl-4-(oxiran-2-ylmethoxy)phenyl]-3-(oxiran-2-ylmethoxy)benzenethiol (PubChem CID 129210392) has the molecular formula C19H20INO4S and a molecular weight of 485.34 g/mol. Its IUPAC name is 4-amino-2-iodo-6-[3-methyl-4-(oxiran-2-ylmethoxy)phenyl]-3-(oxiran-2-ylmethoxy)benzenethiol.
| Compound Name | 4-amino-2-iodo-6-[3-methyl-4-(oxiran-2-ylmethoxy)phenyl]-3-(oxiran-2-ylmethoxy)benzenethiol |
|---|---|
| PubChem CID | 129210392 |
| Molecular Formula | C19H20INO4S |
| Molecular Weight | 485.34 g/mol |
| Exact Mass | 485.02 |
| IUPAC Name | 4-amino-2-iodo-6-[3-methyl-4-(oxiran-2-ylmethoxy)phenyl]-3-(oxiran-2-ylmethoxy)benzenethiol |
| SMILES | Cc1cc(-c2cc(N)c(OCC3CO3)c(I)c2S)ccc1OCC1CO1 |
| InChI | InChI=1S/C19H20INO4S/c1-10-4-11(2-3-16(10)24-8-12-6-22-12)14-5-15(21)18(17(20)19(14)26)25-9-13-7-23-13/h2-5,12-13,26H,6-9,21H2,1H3 |
| InChIKey | VTKVGPRHWGYQTG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|