C29H28O8 — CID 151526658
2-[4-[6-carboxy-2-methyl-3-(oxiran-2-ylmethoxy)phenyl]-3-methylphenyl]-3-methyl-4-(oxiran-2-ylmethoxy)benzoic acid (PubChem CID 151526658) has the molecular formula C29H28O8 and a molecular weight of 504.54 g/mol. Its IUPAC name is 2-[4-[6-carboxy-2-methyl-3-(oxiran-2-ylmethoxy)phenyl]-3-methylphenyl]-3-methyl-4-(oxiran-2-ylmethoxy)benzoic acid.
| Compound Name | 2-[4-[6-carboxy-2-methyl-3-(oxiran-2-ylmethoxy)phenyl]-3-methylphenyl]-3-methyl-4-(oxiran-2-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 151526658 |
| Molecular Formula | C29H28O8 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 2-[4-[6-carboxy-2-methyl-3-(oxiran-2-ylmethoxy)phenyl]-3-methylphenyl]-3-methyl-4-(oxiran-2-ylmethoxy)benzoic acid |
| SMILES | Cc1cc(-c2c(C(=O)O)ccc(OCC3CO3)c2C)ccc1-c1c(C(=O)O)ccc(OCC2CO2)c1C |
| InChI | InChI=1S/C29H28O8/c1-15-10-18(26-16(2)24(36-13-19-11-34-19)8-6-22(26)28(30)31)4-5-21(15)27-17(3)25(37-14-20-12-35-20)9-7-23(27)29(32)33/h4-10,19-20H,11-14H2,1-3H3,(H,30,31)(H,32,33) |
| InChIKey | PVPCLQXNVXNKKN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|