C37H34O10 — CID 118975617
[4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-3-(oxiran-2-ylmethoxy)phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate (PubChem CID 118975617) has the molecular formula C37H34O10 and a molecular weight of 638.67 g/mol. Its IUPAC name is [4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-3-(oxiran-2-ylmethoxy)phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-3-(oxiran-2-ylmethoxy)phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118975617 |
| Molecular Formula | C37H34O10 |
| Molecular Weight | 638.67 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | [4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-3-(oxiran-2-ylmethoxy)phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(-c3ccc(OC(=O)C(=C)C)c(OC(=O)C(=C)C)c3)c(OCC3CO3)c2)cc1OC(=O)C(=C)C |
| InChI | InChI=1S/C37H34O10/c1-20(2)34(38)44-29-13-10-25(16-32(29)46-36(40)22(5)6)24-9-12-28(31(15-24)43-19-27-18-42-27)26-11-14-30(45-35(39)21(3)4)33(17-26)47-37(41)23(7)8/h9-17,27H,1,3,5,7,18-19H2,2,4,6,8H3 |
| InChIKey | DJRQJXHMAVLELB-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 126.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.67 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|