C33H30O6 — CID 148983467
[4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-prop-1-en-2-ylphenyl] 2-methylprop-2-enoate (PubChem CID 148983467) has the molecular formula C33H30O6 and a molecular weight of 522.60 g/mol. Its IUPAC name is [4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-prop-1-en-2-ylphenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-prop-1-en-2-ylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 148983467 |
| Molecular Formula | C33H30O6 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | [4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-prop-1-en-2-ylphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(-c3ccc(OC(=O)C(=C)C)c(C(=C)C)c3)cc2)cc1OC(=O)C(=C)C |
| InChI | InChI=1S/C33H30O6/c1-19(2)27-17-25(13-15-28(27)37-31(34)20(3)4)23-9-11-24(12-10-23)26-14-16-29(38-32(35)21(5)6)30(18-26)39-33(36)22(7)8/h9-18H,1,3,5,7H2,2,4,6,8H3 |
| InChIKey | PWESAIQECNEWKL-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|