C34H32O8 — CID 138462496
[4-[3-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylpropanoate (PubChem CID 138462496) has the molecular formula C34H32O8 and a molecular weight of 568.62 g/mol. Its IUPAC name is [4-[3-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylpropanoate.
| Compound Name | [4-[3-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 138462496 |
| Molecular Formula | C34H32O8 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | [4-[3-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylpropanoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2cccc(-c3ccc(OC(=O)C(C)C)c(OC(=O)C(=C)C)c3)c2)cc1OC(=O)C(=C)C |
| InChI | InChI=1S/C34H32O8/c1-19(2)31(35)39-27-14-12-25(17-29(27)41-33(37)21(5)6)23-10-9-11-24(16-23)26-13-15-28(40-32(36)20(3)4)30(18-26)42-34(38)22(7)8/h9-18,20H,1,5,7H2,2-4,6,8H3 |
| InChIKey | ZFSSYDDRFHXHPF-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|