C42H37FO8 — CID 130280784
[4-[4-[(E)-2-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-2-fluorophenyl]ethenyl]phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylpropanoate (PubChem CID 130280784) has the molecular formula C42H37FO8 and a molecular weight of 688.75 g/mol. Its IUPAC name is [4-[4-[(E)-2-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-2-fluorophenyl]ethenyl]phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylpropanoate.
| Compound Name | [4-[4-[(E)-2-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-2-fluorophenyl]ethenyl]phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 130280784 |
| Molecular Formula | C42H37FO8 |
| Molecular Weight | 688.75 g/mol |
| Exact Mass | 688.25 |
| IUPAC Name | [4-[4-[(E)-2-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-2-fluorophenyl]ethenyl]phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylpropanoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(/C=C/c3ccc(-c4ccc(OC(=O)C(C)C)c(OC(=O)C(=C)C)c4)cc3)c(F)c2)cc1OC(=O)C(=C)C |
| InChI | InChI=1S/C42H37FO8/c1-24(2)39(44)48-35-19-17-32(22-37(35)50-41(46)26(5)6)29-12-9-28(10-13-29)11-14-30-15-16-31(21-34(30)43)33-18-20-36(49-40(45)25(3)4)38(23-33)51-42(47)27(7)8/h9-24H,3,5,7H2,1-2,4,6,8H3/b14-11+ |
| InChIKey | UBPQLGVTBFMUKL-SDNWHVSQSA-N |
| XLogP | 9.34 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.75 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|