C42H38O8 — CID 130281135
[4-[4-[(E)-2-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]ethenyl]phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylpropanoate (PubChem CID 130281135) has the molecular formula C42H38O8 and a molecular weight of 670.76 g/mol. Its IUPAC name is [4-[4-[(E)-2-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]ethenyl]phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylpropanoate.
| Compound Name | [4-[4-[(E)-2-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]ethenyl]phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 130281135 |
| Molecular Formula | C42H38O8 |
| Molecular Weight | 670.76 g/mol |
| Exact Mass | 670.26 |
| IUPAC Name | [4-[4-[(E)-2-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]phenyl]ethenyl]phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylpropanoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(/C=C/c3ccc(-c4ccc(OC(=O)C(C)C)c(OC(=O)C(=C)C)c4)cc3)cc2)cc1OC(=O)C(=C)C |
| InChI | InChI=1S/C42H38O8/c1-25(2)39(43)47-35-21-19-33(23-37(35)49-41(45)27(5)6)31-15-11-29(12-16-31)9-10-30-13-17-32(18-14-30)34-20-22-36(48-40(44)26(3)4)38(24-34)50-42(46)28(7)8/h9-24,26H,1,5,7H2,2-4,6,8H3/b10-9+ |
| InChIKey | VATZPMNNPRVFAA-MDZDMXLPSA-N |
| XLogP | 9.20 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.76 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|