C50H46O12 — CID 118907394
[2-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-5-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-3-[(E)-2-methylbut-2-enoyl]oxyphenyl]phenyl] (E)-2-methylbut-2-enoate (PubChem CID 118907394) has the molecular formula C50H46O12 and a molecular weight of 838.91 g/mol. Its IUPAC name is [2-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-5-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-3-[(E)-2-methylbut-2-enoyl]oxyphenyl]phenyl] (E)-2-methylbut-2-enoate.
| Compound Name | [2-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-5-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-3-[(E)-2-methylbut-2-enoyl]oxyphenyl]phenyl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 118907394 |
| Molecular Formula | C50H46O12 |
| Molecular Weight | 838.91 g/mol |
| Exact Mass | 838.30 |
| IUPAC Name | [2-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-5-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-3-[(E)-2-methylbut-2-enoyl]oxyphenyl]phenyl] (E)-2-methylbut-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(-c3ccc(-c4ccc(OC(=O)C(=C)C)c(OC(=O)C(=C)C)c4)c(OC(=O)/C(C)=C/C)c3)cc2OC(=O)/C(C)=C/C)cc1OC(=O)C(=C)C |
| InChI | InChI=1S/C50H46O12/c1-13-31(11)49(55)59-41-23-33(15-19-37(41)35-17-21-39(57-45(51)27(3)4)43(25-35)61-47(53)29(7)8)34-16-20-38(42(24-34)60-50(56)32(12)14-2)36-18-22-40(58-46(52)28(5)6)44(26-36)62-48(54)30(9)10/h13-26H,3,5,7,9H2,1-2,4,6,8,10-12H3/b31-13+,32-14+ |
| InChIKey | AEOAOQMFYSOEHO-GCFMLEDASA-N |
| XLogP | 10.36 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.91 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|