C30H24F2O6 — CID 130280856
[4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-2,3-difluorophenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 130280856) has the molecular formula C30H24F2O6 and a molecular weight of 518.51 g/mol. Its IUPAC name is [4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-2,3-difluorophenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-2,3-difluorophenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 130280856 |
| Molecular Formula | C30H24F2O6 |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | [4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-2,3-difluorophenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(-c3ccc(OC(=O)C(=C)C)c(OC(=O)C(=C)C)c3)c(F)c2F)cc1 |
| InChI | InChI=1S/C30H24F2O6/c1-16(2)28(33)36-21-10-7-19(8-11-21)22-12-13-23(27(32)26(22)31)20-9-14-24(37-29(34)17(3)4)25(15-20)38-30(35)18(5)6/h7-15H,1,3,5H2,2,4,6H3 |
| InChIKey | DYDFCFSOWBCGEH-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|