C42H37FO12 — CID 118975640
[4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-3-fluoro-2,5-bis(2-methylprop-2-enoyloxy)phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate (PubChem CID 118975640) has the molecular formula C42H37FO12 and a molecular weight of 752.74 g/mol. Its IUPAC name is [4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-3-fluoro-2,5-bis(2-methylprop-2-enoyloxy)phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-3-fluoro-2,5-bis(2-methylprop-2-enoyloxy)phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118975640 |
| Molecular Formula | C42H37FO12 |
| Molecular Weight | 752.74 g/mol |
| Exact Mass | 752.23 |
| IUPAC Name | [4-[4-[3,4-bis(2-methylprop-2-enoyloxy)phenyl]-3-fluoro-2,5-bis(2-methylprop-2-enoyloxy)phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2cc(OC(=O)C(=C)C)c(-c3ccc(OC(=O)C(=C)C)c(OC(=O)C(=C)C)c3)c(F)c2OC(=O)C(=C)C)cc1OC(=O)C(=C)C |
| InChI | InChI=1S/C42H37FO12/c1-20(2)37(44)50-29-15-13-26(17-31(29)52-39(46)22(5)6)28-19-33(54-41(48)24(9)10)34(35(43)36(28)55-42(49)25(11)12)27-14-16-30(51-38(45)21(3)4)32(18-27)53-40(47)23(7)8/h13-19H,1,3,5,7,9,11H2,2,4,6,8,10,12H3 |
| InChIKey | XEOLJEHIKQPNKN-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.74 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|