C20H14F4O4 — CID 59510821
[4-[3,5-difluoro-4-(2-methylprop-2-enoyloxy)phenyl]-2,3-difluorophenyl] 2-methylprop-2-enoate (PubChem CID 59510821) has the molecular formula C20H14F4O4 and a molecular weight of 394.32 g/mol. Its IUPAC name is [4-[3,5-difluoro-4-(2-methylprop-2-enoyloxy)phenyl]-2,3-difluorophenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[3,5-difluoro-4-(2-methylprop-2-enoyloxy)phenyl]-2,3-difluorophenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59510821 |
| Molecular Formula | C20H14F4O4 |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [4-[3,5-difluoro-4-(2-methylprop-2-enoyloxy)phenyl]-2,3-difluorophenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2cc(F)c(OC(=O)C(=C)C)c(F)c2)c(F)c1F |
| InChI | InChI=1S/C20H14F4O4/c1-9(2)19(25)27-15-6-5-12(16(23)17(15)24)11-7-13(21)18(14(22)8-11)28-20(26)10(3)4/h5-8H,1,3H2,2,4H3 |
| InChIKey | QZBCQJFNQHQXHI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|