C21H20F4O4 — CID 126595753
[4-[3,5-difluoro-4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]-2,3-difluorophenyl] 2,2-dimethylpropanoate (PubChem CID 126595753) has the molecular formula C21H20F4O4 and a molecular weight of 412.38 g/mol. Its IUPAC name is [4-[3,5-difluoro-4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]-2,3-difluorophenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[3,5-difluoro-4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]-2,3-difluorophenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 126595753 |
| Molecular Formula | C21H20F4O4 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [4-[3,5-difluoro-4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]-2,3-difluorophenyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(O)Oc1c(F)cc(-c2ccc(OC(=O)C(C)(C)C)c(F)c2F)cc1F |
| InChI | InChI=1S/C21H20F4O4/c1-10(2)19(26)29-18-13(22)8-11(9-14(18)23)12-6-7-15(17(25)16(12)24)28-20(27)21(3,4)5/h6-9,19,26H,1H2,2-5H3 |
| InChIKey | RUKGBTZJALGURG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|