C29H35FO6 — CID 155420683
[2-[[4-[3-fluoro-4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]phenyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2,2-dimethylpropanoate (PubChem CID 155420683) has the molecular formula C29H35FO6 and a molecular weight of 498.59 g/mol. Its IUPAC name is [2-[[4-[3-fluoro-4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]phenyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[[4-[3-fluoro-4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]phenyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 155420683 |
| Molecular Formula | C29H35FO6 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | [2-[[4-[3-fluoro-4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]phenyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(C)(C)C)Cc1ccc(-c2ccc(OC(O)C(=C)C)c(F)c2)cc1 |
| InChI | InChI=1S/C29H35FO6/c1-18(2)26(31)34-16-21(17-35-28(33)29(5,6)7)14-20-8-10-22(11-9-20)23-12-13-25(24(30)15-23)36-27(32)19(3)4/h8-13,15,21,27,32H,1,3,14,16-17H2,2,4-7H3 |
| InChIKey | YDBPIPJMRSZQCZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|