C29H34O6 — CID 146513219
[4-[4-[3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propyl]phenyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 146513219) has the molecular formula C29H34O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is [4-[4-[3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propyl]phenyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[4-[3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propyl]phenyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146513219 |
| Molecular Formula | C29H34O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | [4-[4-[3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propyl]phenyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)C)Cc1ccc(-c2ccc(OC(=O)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H34O6/c1-19(2)26(30)33-17-22(18-34-27(31)20(3)4)16-21-8-10-23(11-9-21)24-12-14-25(15-13-24)35-28(32)29(5,6)7/h8-15,22H,1,3,16-18H2,2,4-7H3 |
| InChIKey | WOKNGUKLTLJGHE-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|