C27H30O6 — CID 123357249
[2-[[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]methyl]-3-propanoyloxypropyl] 2-methylprop-2-enoate (PubChem CID 123357249) has the molecular formula C27H30O6 and a molecular weight of 450.53 g/mol. Its IUPAC name is [2-[[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]methyl]-3-propanoyloxypropyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]methyl]-3-propanoyloxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123357249 |
| Molecular Formula | C27H30O6 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | [2-[[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]methyl]-3-propanoyloxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)CC)Cc1ccc(-c2ccc(OC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C27H30O6/c1-6-25(28)31-16-21(17-32-26(29)18(2)3)15-20-7-9-22(10-8-20)23-11-13-24(14-12-23)33-27(30)19(4)5/h7-14,21H,2,4,6,15-17H2,1,3,5H3 |
| InChIKey | OQFLUOWKHDENQQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|