C28H31FO5 — CID 126569823
[2-[[4-[3-fluoro-4-(2-methylprop-2-enoxy)phenyl]phenyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate (PubChem CID 126569823) has the molecular formula C28H31FO5 and a molecular weight of 466.55 g/mol. Its IUPAC name is [2-[[4-[3-fluoro-4-(2-methylprop-2-enoxy)phenyl]phenyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[4-[3-fluoro-4-(2-methylprop-2-enoxy)phenyl]phenyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 126569823 |
| Molecular Formula | C28H31FO5 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | [2-[[4-[3-fluoro-4-(2-methylprop-2-enoxy)phenyl]phenyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)COc1ccc(-c2ccc(CC(COC(=O)C(=C)C)COC(=O)C(=C)C)cc2)cc1F |
| InChI | InChI=1S/C28H31FO5/c1-18(2)15-32-26-12-11-24(14-25(26)29)23-9-7-21(8-10-23)13-22(16-33-27(30)19(3)4)17-34-28(31)20(5)6/h7-12,14,22H,1,3,5,13,15-17H2,2,4,6H3 |
| InChIKey | SAUWHFFNVOVLNX-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|