C30H37FO6 — CID 167074535
[2-[[4-[3-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]phenyl]methyl]-3-(2-methylprop-2-enoxymethoxy)propyl] 2,2-dimethylpropanoate (PubChem CID 167074535) has the molecular formula C30H37FO6 and a molecular weight of 512.62 g/mol. Its IUPAC name is [2-[[4-[3-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]phenyl]methyl]-3-(2-methylprop-2-enoxymethoxy)propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[[4-[3-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]phenyl]methyl]-3-(2-methylprop-2-enoxymethoxy)propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 167074535 |
| Molecular Formula | C30H37FO6 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | [2-[[4-[3-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]phenyl]methyl]-3-(2-methylprop-2-enoxymethoxy)propyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)COCOCC(COC(=O)C(C)(C)C)Cc1ccc(-c2ccc(OC(=O)C(=C)C)c(F)c2)cc1 |
| InChI | InChI=1S/C30H37FO6/c1-20(2)16-34-19-35-17-23(18-36-29(33)30(5,6)7)14-22-8-10-24(11-9-22)25-12-13-27(26(31)15-25)37-28(32)21(3)4/h8-13,15,23H,1,3,14,16-19H2,2,4-7H3 |
| InChIKey | BNWYLLLOGHWGKJ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|