C27H29FO6 — CID 167020426
[2-[4-[3-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]-3-(2-methylprop-2-enoxy)propyl] 2-methylprop-2-enoate (PubChem CID 167020426) has the molecular formula C27H29FO6 and a molecular weight of 468.52 g/mol. Its IUPAC name is [2-[4-[3-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]-3-(2-methylprop-2-enoxy)propyl] 2-methylprop-2-enoate.
| Compound Name | [2-[4-[3-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]-3-(2-methylprop-2-enoxy)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 167020426 |
| Molecular Formula | C27H29FO6 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | [2-[4-[3-fluoro-4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]-3-(2-methylprop-2-enoxy)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)COCC(COC(=O)C(=C)C)Oc1ccc(-c2ccc(OC(=O)C(=C)C)c(F)c2)cc1 |
| InChI | InChI=1S/C27H29FO6/c1-17(2)14-31-15-23(16-32-26(29)18(3)4)33-22-10-7-20(8-11-22)21-9-12-25(24(28)13-21)34-27(30)19(5)6/h7-13,23H,1,3,5,14-16H2,2,4,6H3 |
| InChIKey | JQQJBLZXQAMMIN-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|